About 4-chloro-2,7,8-trimethylquinoline
4-chloro-2,7,8-trimethylquinoline (PubChem CID 16765326) has the molecular formula C12H12ClN
and a molecular weight of 205.69 g/mol. Its IUPAC name is 4-chloro-2,7,8-trimethylquinoline.
Molecular Properties
| Compound Name | 4-chloro-2,7,8-trimethylquinoline |
| PubChem CID | 16765326 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-chloro-2,7,8-trimethylquinoline |
| SMILES | Cc1cc(Cl)c2ccc(C)c(C)c2n1 |
| InChI | InChI=1S/C12H12ClN/c1-7-4-5-10-11(13)6-8(2)14-12(10)9(7)3/h4-6H,1-3H3 |
| InChIKey | NDTSUKTWPJRMAV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2,7,8-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,7,8-trimethylquinoline?
The IUPAC name of 4-chloro-2,7,8-trimethylquinoline (CID 16765326) is 4-chloro-2,7,8-trimethylquinoline.
What is the SMILES notation for 4-chloro-2,7,8-trimethylquinoline?
The canonical SMILES for 4-chloro-2,7,8-trimethylquinoline is Cc1cc(Cl)c2ccc(C)c(C)c2n1.
What is the InChIKey of 4-chloro-2,7,8-trimethylquinoline?
The InChIKey is NDTSUKTWPJRMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN/c1-7-4-5-10-11(13)6-8(2)14-12(10)9(7)3/h4-6H,1-3H3.
What are the key properties of 4-chloro-2,7,8-trimethylquinoline?
4-chloro-2,7,8-trimethylquinoline has a molecular weight of 205.69 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,7,8-trimethylquinoline is sourced from PubChem (CID 16765326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).