C30H44N4O4S2 — CID 167654556
tert-butyl 2-benzyl-3-(carbamothioylamino)propanoate;tert-butyl 3-[benzyl(carbamothioyl)amino]propanoate (PubChem CID 167654556) has the molecular formula C30H44N4O4S2 and a molecular weight of 588.84 g/mol. Its IUPAC name is tert-butyl 2-benzyl-3-(carbamothioylamino)propanoate;tert-butyl 3-[benzyl(carbamothioyl)amino]propanoate.
| Compound Name | tert-butyl 2-benzyl-3-(carbamothioylamino)propanoate;tert-butyl 3-[benzyl(carbamothioyl)amino]propanoate |
|---|---|
| PubChem CID | 167654556 |
| Molecular Formula | C30H44N4O4S2 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | tert-butyl 2-benzyl-3-(carbamothioylamino)propanoate;tert-butyl 3-[benzyl(carbamothioyl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)C(CNC(N)=S)Cc1ccccc1.CC(C)(C)OC(=O)CCN(Cc1ccccc1)C(N)=S |
| InChI | InChI=1S/2C15H22N2O2S/c1-15(2,3)19-13(18)12(10-17-14(16)20)9-11-7-5-4-6-8-11;1-15(2,3)19-13(18)9-10-17(14(16)20)11-12-7-5-4-6-8-12/h4-8,12H,9-10H2,1-3H3,(H3,16,17,20);4-8H,9-11H2,1-3H3,(H2,16,20) |
| InChIKey | RBJOVJYJNVSPII-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|