About 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane
1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane (PubChem CID 167654749) has the molecular formula C8H17NOS
and a molecular weight of 175.30 g/mol. Its IUPAC name is 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane.
Molecular Properties
| Compound Name | 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane |
| PubChem CID | 167654749 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane |
| SMILES | OC1([C@@H]2CCN2)CCCC1.S |
| InChI | InChI=1S/C8H15NO.H2S/c10-8(4-1-2-5-8)7-3-6-9-7;/h7,9-10H,1-6H2;1H2/t7-;/m0./s1 |
| InChIKey | RCANTZFUXRSRJL-FJXQXJEOSA-N |
| XLogP | 0.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane?
The IUPAC name of 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane (CID 167654749) is 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane.
What is the SMILES notation for 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane?
The canonical SMILES for 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane is OC1([C@@H]2CCN2)CCCC1.S.
What is the InChIKey of 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane?
The InChIKey is RCANTZFUXRSRJL-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H15NO.H2S/c10-8(4-1-2-5-8)7-3-6-9-7;/h7,9-10H,1-6H2;1H2/t7-;/m0./s1.
What are the key properties of 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane?
1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane has a molecular weight of 175.30 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-azetidin-2-yl]cyclopentan-1-ol;sulfane is sourced from PubChem (CID 167654749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).