C20H20BrFO4 — CID 167655423
tert-butyl 2-[3-[(4-bromo-2-fluoro-3-formylphenoxy)methyl]phenyl]acetate (PubChem CID 167655423) has the molecular formula C20H20BrFO4 and a molecular weight of 423.28 g/mol. Its IUPAC name is tert-butyl 2-[3-[(4-bromo-2-fluoro-3-formylphenoxy)methyl]phenyl]acetate.
| Compound Name | tert-butyl 2-[3-[(4-bromo-2-fluoro-3-formylphenoxy)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 167655423 |
| Molecular Formula | C20H20BrFO4 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | tert-butyl 2-[3-[(4-bromo-2-fluoro-3-formylphenoxy)methyl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cccc(COc2ccc(Br)c(C=O)c2F)c1 |
| InChI | InChI=1S/C20H20BrFO4/c1-20(2,3)26-18(24)10-13-5-4-6-14(9-13)12-25-17-8-7-16(21)15(11-23)19(17)22/h4-9,11H,10,12H2,1-3H3 |
| InChIKey | REMQCHSGFFQYIM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|