C17H38N2O6 — CID 167655560
N-[(1R,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxypentanamide;ethane (PubChem CID 167655560) has the molecular formula C17H38N2O6 and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[(1R,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxypentanamide;ethane.
| Compound Name | N-[(1R,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxypentanamide;ethane |
|---|---|
| PubChem CID | 167655560 |
| Molecular Formula | C17H38N2O6 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | N-[(1R,3R,4R,5S)-5-amino-2-hydroxy-3,4-dimethoxycyclohexyl]-2,3-dihydroxypentanamide;ethane |
| SMILES | CC.CC.CCC(O)C(O)C(=O)N[C@@H]1C[C@H](N)[C@@H](OC)[C@H](OC)C1O |
| InChI | InChI=1S/C13H26N2O6.2C2H6/c1-4-8(16)10(18)13(19)15-7-5-6(14)11(20-2)12(21-3)9(7)17;2*1-2/h6-12,16-18H,4-5,14H2,1-3H3,(H,15,19);2*1-2H3/t6-,7+,8?,9?,10?,11+,12+;;/m0../s1 |
| InChIKey | REZAPKMTDXHGDH-HAWIFBMCSA-N |
| XLogP | -0.22 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |