C18H8Cl4N2O2 — CID 167655719
phenazine;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 167655719) has the molecular formula C18H8Cl4N2O2 and a molecular weight of 426.09 g/mol. Its IUPAC name is phenazine;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | phenazine;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 167655719 |
| Molecular Formula | C18H8Cl4N2O2 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 423.93 |
| IUPAC Name | phenazine;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.C6Cl4O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;7-1-2(8)6(12)4(10)3(9)5(1)11/h1-8H; |
| InChIKey | RFOLTIMGDDHMBF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|