About 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid
3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid (PubChem CID 167656051) has the molecular formula C22H19F3O4S
and a molecular weight of 436.45 g/mol. Its IUPAC name is 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid |
| PubChem CID | 167656051 |
| Molecular Formula | C22H19F3O4S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(C(F)(F)F)ccc1C1=CC=CC1 |
| InChI | InChI=1S/C22H19F3O4S/c1-2-14-7-8-16(21(26)27)12-20(14)30(28,29)13-17-11-18(22(23,24)25)9-10-19(17)15-5-3-4-6-15/h3-5,7-12H,2,6,13H2,1H3,(H,26,27) |
| InChIKey | NUPWFFDLPVLKCR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid?
The IUPAC name of 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid (CID 167656051) is 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid.
What is the SMILES notation for 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid?
The canonical SMILES for 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid is CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(C(F)(F)F)ccc1C1=CC=CC1.
What is the InChIKey of 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid?
The InChIKey is NUPWFFDLPVLKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3O4S/c1-2-14-7-8-16(21(26)27)12-20(14)30(28,29)13-17-11-18(22(23,24)25)9-10-19(17)15-5-3-4-6-15/h3-5,7-12H,2,6,13H2,1H3,(H,26,27).
What are the key properties of 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid?
3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid has a molecular weight of 436.45 g/mol, XLogP of 5.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-cyclopenta-1,3-dien-1-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]-4-ethylbenzoic acid is sourced from PubChem (CID 167656051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).