C23H23BrFN3O4S — CID 167656831
[2-(3-bromo-5-fluorophenyl)-6-[(6-piperidin-1-yl-3-pyridinyl)oxy]-4-pyridinyl]methyl methanesulfonate (PubChem CID 167656831) has the molecular formula C23H23BrFN3O4S and a molecular weight of 536.42 g/mol. Its IUPAC name is [2-(3-bromo-5-fluorophenyl)-6-[(6-piperidin-1-yl-3-pyridinyl)oxy]-4-pyridinyl]methyl methanesulfonate.
| Compound Name | [2-(3-bromo-5-fluorophenyl)-6-[(6-piperidin-1-yl-3-pyridinyl)oxy]-4-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 167656831 |
| Molecular Formula | C23H23BrFN3O4S |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | [2-(3-bromo-5-fluorophenyl)-6-[(6-piperidin-1-yl-3-pyridinyl)oxy]-4-pyridinyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc(Oc2ccc(N3CCCCC3)nc2)nc(-c2cc(F)cc(Br)c2)c1 |
| InChI | InChI=1S/C23H23BrFN3O4S/c1-33(29,30)31-15-16-9-21(17-11-18(24)13-19(25)12-17)27-23(10-16)32-20-5-6-22(26-14-20)28-7-3-2-4-8-28/h5-6,9-14H,2-4,7-8,15H2,1H3 |
| InChIKey | RJOZXGDOECVQGO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|