C36H44N6O5 — CID 167657036
1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-[6-morpholin-4-yl-7-(oxan-2-yl)purin-2-yl]phenyl]propan-2-one (PubChem CID 167657036) has the molecular formula C36H44N6O5 and a molecular weight of 640.79 g/mol. Its IUPAC name is 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-[6-morpholin-4-yl-7-(oxan-2-yl)purin-2-yl]phenyl]propan-2-one.
| Compound Name | 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-[6-morpholin-4-yl-7-(oxan-2-yl)purin-2-yl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 167657036 |
| Molecular Formula | C36H44N6O5 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-[6-morpholin-4-yl-7-(oxan-2-yl)purin-2-yl]phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(COCCN2CCOCC2)cc1)Cc1ccc(-c2nc(N3CCOCC3)c3c(ncn3C3CCCCO3)n2)cc1 |
| InChI | InChI=1S/C36H44N6O5/c43-31(23-27-4-6-29(7-5-27)25-46-20-14-40-12-18-44-19-13-40)24-28-8-10-30(11-9-28)34-38-35-33(36(39-34)41-15-21-45-22-16-41)42(26-37-35)32-3-1-2-17-47-32/h4-11,26,32H,1-3,12-25H2 |
| InChIKey | MSJKLGQQWIZCGA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|