About 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine
7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine (PubChem CID 16765714) has the molecular formula C19H10BrCl2N3
and a molecular weight of 431.12 g/mol. Its IUPAC name is 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine |
| PubChem CID | 16765714 |
| Molecular Formula | C19H10BrCl2N3 |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 428.94 |
| IUPAC Name | 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine |
| SMILES | Clc1ccc(-c2nc3cc(Br)cnc3nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H10BrCl2N3/c20-13-9-16-19(23-10-13)25-18(12-3-7-15(22)8-4-12)17(24-16)11-1-5-14(21)6-2-11/h1-10H |
| InChIKey | KRKKMGADVRXUDY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine?
The IUPAC name of 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine (CID 16765714) is 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine.
What is the SMILES notation for 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine?
The canonical SMILES for 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine is Clc1ccc(-c2nc3cc(Br)cnc3nc2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine?
The InChIKey is KRKKMGADVRXUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10BrCl2N3/c20-13-9-16-19(23-10-13)25-18(12-3-7-15(22)8-4-12)17(24-16)11-1-5-14(21)6-2-11/h1-10H.
What are the key properties of 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine?
7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine has a molecular weight of 431.12 g/mol, XLogP of 6.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3-bis(4-chlorophenyl)pyrido[2,3-b]pyrazine is sourced from PubChem (CID 16765714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).