About 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane
2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane (PubChem CID 167657578) has the molecular formula C20H30IN3O2
and a molecular weight of 471.38 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane.
Molecular Properties
| Compound Name | 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane |
| PubChem CID | 167657578 |
| Molecular Formula | C20H30IN3O2 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane |
| SMILES | CC1CCCC(C)N1CCCN1Cc2cccc(C(N)=O)c2C1=O.CI |
| InChI | InChI=1S/C19H27N3O2.CH3I/c1-13-6-3-7-14(2)22(13)11-5-10-21-12-15-8-4-9-16(18(20)23)17(15)19(21)24;1-2/h4,8-9,13-14H,3,5-7,10-12H2,1-2H3,(H2,20,23);1H3 |
| InChIKey | RMGKQQUPHCHHLE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane?
The IUPAC name of 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane (CID 167657578) is 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane.
What is the SMILES notation for 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane?
The canonical SMILES for 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane is CC1CCCC(C)N1CCCN1Cc2cccc(C(N)=O)c2C1=O.CI.
What is the InChIKey of 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane?
The InChIKey is RMGKQQUPHCHHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2.CH3I/c1-13-6-3-7-14(2)22(13)11-5-10-21-12-15-8-4-9-16(18(20)23)17(15)19(21)24;1-2/h4,8-9,13-14H,3,5-7,10-12H2,1-2H3,(H2,20,23);1H3.
What are the key properties of 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane?
2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane has a molecular weight of 471.38 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-dimethylpiperidin-1-yl)propyl]-3-oxo-1H-isoindole-4-carboxamide;iodomethane is sourced from PubChem (CID 167657578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).