C15H15FN4O3 — CID 16765759
3-cyclopropyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 16765759) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 16765759 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-cyclopropyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(C2CC2)no1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN4O3/c16-11-5-3-10(4-6-11)13(21)17-7-8-18-14(22)15-19-12(20-23-15)9-1-2-9/h3-6,9H,1-2,7-8H2,(H,17,21)(H,18,22) |
| InChIKey | QADKTYGLGGSHCJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|