C14H15Cl2IN2 — CID 167659014
2-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-3-methylimidazol-3-ium iodide (PubChem CID 167659014) has the molecular formula C14H15Cl2IN2 and a molecular weight of 409.10 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-3-methylimidazol-3-ium iodide.
| Compound Name | 2-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-3-methylimidazol-3-ium iodide |
|---|---|
| PubChem CID | 167659014 |
| Molecular Formula | C14H15Cl2IN2 |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 2-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]-3-methylimidazol-3-ium iodide |
| SMILES | C[n+]1ccn(Cc2c(Cl)cccc2Cl)c1C1CC1.[I-] |
| InChI | InChI=1S/C14H15Cl2N2.HI/c1-17-7-8-18(14(17)10-5-6-10)9-11-12(15)3-2-4-13(11)16;/h2-4,7-8,10H,5-6,9H2,1H3;1H/q+1;/p-1 |
| InChIKey | DQRUQXAJKUTQHS-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|