C18H13F3N4O3 — CID 167659066
N-(2-oxoethyl)-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide (PubChem CID 167659066) has the molecular formula C18H13F3N4O3 and a molecular weight of 390.32 g/mol. Its IUPAC name is N-(2-oxoethyl)-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide.
| Compound Name | N-(2-oxoethyl)-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167659066 |
| Molecular Formula | C18H13F3N4O3 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(2-oxoethyl)-5-[[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]amino]pyridine-2-carboxamide |
| SMILES | O=CCNC(=O)c1ccc(Nc2ncc(-c3ccc(C(F)(F)F)cc3)o2)cn1 |
| InChI | InChI=1S/C18H13F3N4O3/c19-18(20,21)12-3-1-11(2-4-12)15-10-24-17(28-15)25-13-5-6-14(23-9-13)16(27)22-7-8-26/h1-6,8-10H,7H2,(H,22,27)(H,24,25) |
| InChIKey | RRPZPORGRROJIL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|