About N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide
N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide (PubChem CID 16765963) has the molecular formula C22H15NO5
and a molecular weight of 373.36 g/mol. Its IUPAC name is N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide |
| PubChem CID | 16765963 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide |
| SMILES | CC(=O)Nc1c(Oc2ccccc2)cc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H15NO5/c1-12(24)23-20-17(28-13-7-3-2-4-8-13)11-16(25)18-19(20)22(27)15-10-6-5-9-14(15)21(18)26/h2-11,25H,1H3,(H,23,24) |
| InChIKey | KOKAQZDQEVMNSG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide?
The IUPAC name of N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide (CID 16765963) is N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide.
What is the SMILES notation for N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide?
The canonical SMILES for N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide is CC(=O)Nc1c(Oc2ccccc2)cc(O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide?
The InChIKey is KOKAQZDQEVMNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO5/c1-12(24)23-20-17(28-13-7-3-2-4-8-13)11-16(25)18-19(20)22(27)15-10-6-5-9-14(15)21(18)26/h2-11,25H,1H3,(H,23,24).
What are the key properties of N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide?
N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide has a molecular weight of 373.36 g/mol, XLogP of 3.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-9,10-dioxo-2-phenoxyanthracen-1-yl)acetamide is sourced from PubChem (CID 16765963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).