About dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol
dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol (PubChem CID 167660298) has the molecular formula C20H16MnN2O4S2
and a molecular weight of 467.43 g/mol. Its IUPAC name is dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol |
| PubChem CID | 167660298 |
| Molecular Formula | C20H16MnN2O4S2 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol |
| SMILES | O=Cc1cnc(-c2ccccc2)s1.O=[Mn]=O.OCc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H9NOS.C10H7NOS.Mn.2O/c2*12-7-9-6-11-10(13-9)8-4-2-1-3-5-8;;;/h1-6,12H,7H2;1-7H;;; |
| InChIKey | ASCGQNWSYNXYQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol?
The IUPAC name of dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol (CID 167660298) is dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol.
What is the SMILES notation for dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol?
The canonical SMILES for dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol is O=Cc1cnc(-c2ccccc2)s1.O=[Mn]=O.OCc1cnc(-c2ccccc2)s1.
What is the InChIKey of dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol?
The InChIKey is ASCGQNWSYNXYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS.C10H7NOS.Mn.2O/c2*12-7-9-6-11-10(13-9)8-4-2-1-3-5-8;;;/h1-6,12H,7H2;1-7H;;;.
What are the key properties of dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol?
dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol has a molecular weight of 467.43 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomanganese;2-phenyl-1,3-thiazole-5-carbaldehyde;(2-phenyl-1,3-thiazol-5-yl)methanol is sourced from PubChem (CID 167660298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).