About methane;N-propan-2-ylmethanimine
methane;N-propan-2-ylmethanimine (PubChem CID 167660866) has the molecular formula C5H13N
and a molecular weight of 87.17 g/mol. Its IUPAC name is methane;N-propan-2-ylmethanimine.
Molecular Properties
| Compound Name | methane;N-propan-2-ylmethanimine |
| PubChem CID | 167660866 |
| Molecular Formula | C5H13N |
| Molecular Weight | 87.17 g/mol |
| Exact Mass | 87.10 |
| IUPAC Name | methane;N-propan-2-ylmethanimine |
| SMILES | C.C=NC(C)C |
| InChI | InChI=1S/C4H9N.CH4/c1-4(2)5-3;/h4H,3H2,1-2H3;1H4 |
| InChIKey | RYBXBULJQJSRFD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;N-propan-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-propan-2-ylmethanimine?
The IUPAC name of methane;N-propan-2-ylmethanimine (CID 167660866) is methane;N-propan-2-ylmethanimine.
What is the SMILES notation for methane;N-propan-2-ylmethanimine?
The canonical SMILES for methane;N-propan-2-ylmethanimine is C.C=NC(C)C.
What is the InChIKey of methane;N-propan-2-ylmethanimine?
The InChIKey is RYBXBULJQJSRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.CH4/c1-4(2)5-3;/h4H,3H2,1-2H3;1H4.
What are the key properties of methane;N-propan-2-ylmethanimine?
methane;N-propan-2-ylmethanimine has a molecular weight of 87.17 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-propan-2-ylmethanimine is sourced from PubChem (CID 167660866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).