C17H14F3N5O2 — CID 167661997
N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenecarboximidate (PubChem CID 167661997) has the molecular formula C17H14F3N5O2 and a molecular weight of 377.33 g/mol. Its IUPAC name is N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenecarboximidate.
| Compound Name | N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenecarboximidate |
|---|---|
| PubChem CID | 167661997 |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(1-methyl-1,2,4-triazol-4-ium-4-yl)-4-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzenecarboximidate |
| SMILES | Cn1c[n+](N=C([O-])c2ccc(-c3ccc(OCC(F)(F)F)nc3)cc2)cn1 |
| InChI | InChI=1S/C17H14F3N5O2/c1-24-11-25(10-22-24)23-16(26)13-4-2-12(3-5-13)14-6-7-15(21-8-14)27-9-17(18,19)20/h2-8,10-11H,9H2,1H3 |
| InChIKey | SBVBHKRMVLTKEL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|