About 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one
3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 16766244) has the molecular formula C10H8N2O6
and a molecular weight of 252.18 g/mol. Its IUPAC name is 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one |
| PubChem CID | 16766244 |
| Molecular Formula | C10H8N2O6 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C10H8N2O6/c13-10-11(1-2-16-10)6-3-8-9(18-5-17-8)4-7(6)12(14)15/h3-4H,1-2,5H2 |
| InChIKey | CLBIAIVJZNKTKZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one (CID 16766244) is 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one is O=C1OCCN1c1cc2c(cc1[N+](=O)[O-])OCO2.
What is the InChIKey of 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The InChIKey is CLBIAIVJZNKTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O6/c13-10-11(1-2-16-10)6-3-8-9(18-5-17-8)4-7(6)12(14)15/h3-4H,1-2,5H2.
What are the key properties of 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one has a molecular weight of 252.18 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-nitro-1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 16766244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).