About 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one
3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 16766249) has the molecular formula C10H9NO4
and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one |
| PubChem CID | 16766249 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9NO4/c12-10-11(3-4-13-10)7-1-2-8-9(5-7)15-6-14-8/h1-2,5H,3-4,6H2 |
| InChIKey | WADWFHPQSOZWMB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one (CID 16766249) is 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one is O=C1OCCN1c1ccc2c(c1)OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
The InChIKey is WADWFHPQSOZWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c12-10-11(3-4-13-10)7-1-2-8-9(5-7)15-6-14-8/h1-2,5H,3-4,6H2.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one?
3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one has a molecular weight of 207.19 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 16766249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).