About 6-propan-2-yl-2H-imidazo[4,5-b]pyridine
6-propan-2-yl-2H-imidazo[4,5-b]pyridine (PubChem CID 167662831) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 6-propan-2-yl-2H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-propan-2-yl-2H-imidazo[4,5-b]pyridine |
| PubChem CID | 167662831 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 6-propan-2-yl-2H-imidazo[4,5-b]pyridine |
| SMILES | CC(C)c1cnc2c(c1)=NCN=2 |
| InChI | InChI=1S/C9H11N3/c1-6(2)7-3-8-9(10-4-7)12-5-11-8/h3-4,6H,5H2,1-2H3 |
| InChIKey | IOEQRTMZCHPTAP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-2H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-2H-imidazo[4,5-b]pyridine?
The IUPAC name of 6-propan-2-yl-2H-imidazo[4,5-b]pyridine (CID 167662831) is 6-propan-2-yl-2H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 6-propan-2-yl-2H-imidazo[4,5-b]pyridine?
The canonical SMILES for 6-propan-2-yl-2H-imidazo[4,5-b]pyridine is CC(C)c1cnc2c(c1)=NCN=2.
What is the InChIKey of 6-propan-2-yl-2H-imidazo[4,5-b]pyridine?
The InChIKey is IOEQRTMZCHPTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6(2)7-3-8-9(10-4-7)12-5-11-8/h3-4,6H,5H2,1-2H3.
What are the key properties of 6-propan-2-yl-2H-imidazo[4,5-b]pyridine?
6-propan-2-yl-2H-imidazo[4,5-b]pyridine has a molecular weight of 161.21 g/mol, XLogP of 0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-2H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 167662831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).