C20H24N6O6S2 — CID 167662951
ethyl (Z)-2-azido-3-[2-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoate;ethyl 2-(methoxymethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 167662951) has the molecular formula C20H24N6O6S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is ethyl (Z)-2-azido-3-[2-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoate;ethyl 2-(methoxymethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate.
| Compound Name | ethyl (Z)-2-azido-3-[2-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoate;ethyl 2-(methoxymethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 167662951 |
| Molecular Formula | C20H24N6O6S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | ethyl (Z)-2-azido-3-[2-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoate;ethyl 2-(methoxymethyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CCOC(=O)/C(=C/c1cnc(COC)s1)N=[N+]=[N-].CCOC(=O)c1cc2sc(COC)nc2[nH]1 |
| InChI | InChI=1S/C10H12N4O3S.C10H12N2O3S/c1-3-17-10(15)8(13-14-11)4-7-5-12-9(18-7)6-16-2;1-3-15-10(13)6-4-7-9(11-6)12-8(16-7)5-14-2/h4-5H,3,6H2,1-2H3;4,11H,3,5H2,1-2H3/b8-4-; |
| InChIKey | SFCHGYKWNHEXEC-ZYFYRQFPSA-N |
| XLogP | 4.45 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|