C22H40O6 — CID 167663886
1,3-bis(2-methylpropanoyloxy)propan-2-yl 9-methyldecanoate (PubChem CID 167663886) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1,3-bis(2-methylpropanoyloxy)propan-2-yl 9-methyldecanoate.
| Compound Name | 1,3-bis(2-methylpropanoyloxy)propan-2-yl 9-methyldecanoate |
|---|---|
| PubChem CID | 167663886 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1,3-bis(2-methylpropanoyloxy)propan-2-yl 9-methyldecanoate |
| SMILES | CC(C)CCCCCCCC(=O)OC(COC(=O)C(C)C)COC(=O)C(C)C |
| InChI | InChI=1S/C22H40O6/c1-16(2)12-10-8-7-9-11-13-20(23)28-19(14-26-21(24)17(3)4)15-27-22(25)18(5)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | YLKGZWJEPSJVSS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|