C24H21FN2O6 — CID 167664309
1-[6-(4-fluoro-3-methylphenyl)-5-methoxy-2-pyridinyl]-4-(3-methoxy-4-nitrophenyl)butane-1,4-dione (PubChem CID 167664309) has the molecular formula C24H21FN2O6 and a molecular weight of 452.44 g/mol. Its IUPAC name is 1-[6-(4-fluoro-3-methylphenyl)-5-methoxy-2-pyridinyl]-4-(3-methoxy-4-nitrophenyl)butane-1,4-dione.
| Compound Name | 1-[6-(4-fluoro-3-methylphenyl)-5-methoxy-2-pyridinyl]-4-(3-methoxy-4-nitrophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 167664309 |
| Molecular Formula | C24H21FN2O6 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-[6-(4-fluoro-3-methylphenyl)-5-methoxy-2-pyridinyl]-4-(3-methoxy-4-nitrophenyl)butane-1,4-dione |
| SMILES | COc1cc(C(=O)CCC(=O)c2ccc(OC)c(-c3ccc(F)c(C)c3)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21FN2O6/c1-14-12-16(4-6-17(14)25)24-22(32-2)11-7-18(26-24)21(29)10-9-20(28)15-5-8-19(27(30)31)23(13-15)33-3/h4-8,11-13H,9-10H2,1-3H3 |
| InChIKey | WZYCILIGZOJGAG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|