About 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine
6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 16766619) has the molecular formula C9H9N5O2
and a molecular weight of 219.20 g/mol. Its IUPAC name is 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine.
Molecular Properties
| Compound Name | 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| PubChem CID | 16766619 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1-n1cnnn1)OCCO2 |
| InChI | InChI=1S/C9H9N5O2/c10-6-3-8-9(16-2-1-15-8)4-7(6)14-5-11-12-13-14/h3-5H,1-2,10H2 |
| InChIKey | NEXVMZMENRATJO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine?
The IUPAC name of 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine (CID 16766619) is 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine.
What is the SMILES notation for 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine?
The canonical SMILES for 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine is Nc1cc2c(cc1-n1cnnn1)OCCO2.
What is the InChIKey of 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine?
The InChIKey is NEXVMZMENRATJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O2/c10-6-3-8-9(16-2-1-15-8)4-7(6)14-5-11-12-13-14/h3-5H,1-2,10H2.
What are the key properties of 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine?
6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine has a molecular weight of 219.20 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(tetrazol-1-yl)-2,3-dihydro-1,4-benzodioxin-7-amine is sourced from PubChem (CID 16766619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).