C16H27FeN4O8 — CID 167666635
2-[[2-(2-aminoethylamino)-2-oxoethyl]-[(1R,2R)-2-[bis(carboxylatomethyl)amino]cyclohexyl]amino]acetate;iron(3+);hydrate (PubChem CID 167666635) has the molecular formula C16H27FeN4O8 and a molecular weight of 459.26 g/mol. Its IUPAC name is 2-[[2-(2-aminoethylamino)-2-oxoethyl]-[(1R,2R)-2-[bis(carboxylatomethyl)amino]cyclohexyl]amino]acetate;iron(3+);hydrate.
| Compound Name | 2-[[2-(2-aminoethylamino)-2-oxoethyl]-[(1R,2R)-2-[bis(carboxylatomethyl)amino]cyclohexyl]amino]acetate;iron(3+);hydrate |
|---|---|
| PubChem CID | 167666635 |
| Molecular Formula | C16H27FeN4O8 |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[[2-(2-aminoethylamino)-2-oxoethyl]-[(1R,2R)-2-[bis(carboxylatomethyl)amino]cyclohexyl]amino]acetate;iron(3+);hydrate |
| SMILES | NCCNC(=O)CN(CC(=O)[O-])[C@@H]1CCCC[C@H]1N(CC(=O)[O-])CC(=O)[O-].O.[Fe+3] |
| InChI | InChI=1S/C16H28N4O7.Fe.H2O/c17-5-6-18-13(21)7-19(8-14(22)23)11-3-1-2-4-12(11)20(9-15(24)25)10-16(26)27;;/h11-12H,1-10,17H2,(H,18,21)(H,22,23)(H,24,25)(H,26,27);;1H2/q;+3;/p-3/t11-,12-;;/m1../s1 |
| InChIKey | UKNJSYNGCNTIJM-MBORUXJMSA-K |
| XLogP | -6.60 |
| TPSA | 213.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|