C30H29BF4N2O6 — CID 167667397
methyl 2,6-difluoro-4-(1H-pyrrol-2-yl)benzoate;methyl 2,6-difluoro-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-2-yl]benzoate (PubChem CID 167667397) has the molecular formula C30H29BF4N2O6 and a molecular weight of 600.37 g/mol. Its IUPAC name is methyl 2,6-difluoro-4-(1H-pyrrol-2-yl)benzoate;methyl 2,6-difluoro-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 2,6-difluoro-4-(1H-pyrrol-2-yl)benzoate;methyl 2,6-difluoro-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 167667397 |
| Molecular Formula | C30H29BF4N2O6 |
| Molecular Weight | 600.37 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | methyl 2,6-difluoro-4-(1H-pyrrol-2-yl)benzoate;methyl 2,6-difluoro-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1c(F)cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)[nH]2)cc1F.COC(=O)c1c(F)cc(-c2ccc[nH]2)cc1F |
| InChI | InChI=1S/C18H20BF2NO4.C12H9F2NO2/c1-17(2)18(3,4)26-19(25-17)14-7-6-13(22-14)10-8-11(20)15(12(21)9-10)16(23)24-5;1-17-12(16)11-8(13)5-7(6-9(11)14)10-3-2-4-15-10/h6-9,22H,1-5H3;2-6,15H,1H3 |
| InChIKey | SVKJALMQARYEKP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|