C26H37BN2O4 — CID 167668992
[(1R)-3-methyl-1-[[(2R)-2-(2-methylpropyl)-4-oxo-5-(N-phenylanilino)pentanoyl]amino]butyl]boronic acid (PubChem CID 167668992) has the molecular formula C26H37BN2O4 and a molecular weight of 452.40 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2R)-2-(2-methylpropyl)-4-oxo-5-(N-phenylanilino)pentanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2R)-2-(2-methylpropyl)-4-oxo-5-(N-phenylanilino)pentanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 167668992 |
| Molecular Formula | C26H37BN2O4 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2R)-2-(2-methylpropyl)-4-oxo-5-(N-phenylanilino)pentanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](CC(=O)CN(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C26H37BN2O4/c1-19(2)15-21(26(31)28-25(27(32)33)16-20(3)4)17-24(30)18-29(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,19-21,25,32-33H,15-18H2,1-4H3,(H,28,31)/t21-,25+/m1/s1 |
| InChIKey | TUYSXRMXIGUZNA-BWKNWUBXSA-N |
| XLogP | 3.99 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|