C20H38O5Si — CID 167669330
(E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoic acid (PubChem CID 167669330) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoic acid |
|---|---|
| PubChem CID | 167669330 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoic acid |
| SMILES | C[C@H](CC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si/c1-14-13-17(25-26(7,8)20(4,5)6)19(24-16(14)3)23-15(2)11-9-10-12-18(21)22/h10,12,14-17,19H,9,11,13H2,1-8H3,(H,21,22)/b12-10+/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | TWHCBTCLKXRCQR-XQTQRCFESA-N |
| XLogP | 4.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|