About triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide
triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide (PubChem CID 167669885) has the molecular formula C12H22BrN3O2S
and a molecular weight of 352.30 g/mol. Its IUPAC name is triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide.
Molecular Properties
| Compound Name | triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide |
| PubChem CID | 167669885 |
| Molecular Formula | C12H22BrN3O2S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide |
| SMILES | CC[N+](CC)(CC)CC(=O)SCCc1ncno1.[Br-] |
| InChI | InChI=1S/C12H22N3O2S.BrH/c1-4-15(5-2,6-3)9-12(16)18-8-7-11-13-10-14-17-11;/h10H,4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HKXNADGYCCJVAF-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide?
The IUPAC name of triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide (CID 167669885) is triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide.
What is the SMILES notation for triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide?
The canonical SMILES for triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide is CC[N+](CC)(CC)CC(=O)SCCc1ncno1.[Br-].
What is the InChIKey of triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide?
The InChIKey is HKXNADGYCCJVAF-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H22N3O2S.BrH/c1-4-15(5-2,6-3)9-12(16)18-8-7-11-13-10-14-17-11;/h10H,4-9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide?
triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide has a molecular weight of 352.30 g/mol, XLogP of -1.25, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[2-[2-(1,2,4-oxadiazol-5-yl)ethylsulfanyl]-2-oxoethyl]azanium bromide is sourced from PubChem (CID 167669885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).