C22H12ClN5S2 — CID 16766990
2-[2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-1,3-benzothiazole (PubChem CID 16766990) has the molecular formula C22H12ClN5S2 and a molecular weight of 445.96 g/mol. Its IUPAC name is 2-[2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 16766990 |
| Molecular Formula | C22H12ClN5S2 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-[2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl]-1,3-benzothiazole |
| SMILES | Clc1ccc(-c2nnc3sc(-c4ccccc4-c4nc5ccccc5s4)nn23)cc1 |
| InChI | InChI=1S/C22H12ClN5S2/c23-14-11-9-13(10-12-14)19-25-26-22-28(19)27-21(30-22)16-6-2-1-5-15(16)20-24-17-7-3-4-8-18(17)29-20/h1-12H |
| InChIKey | MCJIPXAIZZYVJK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |