About 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide
5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 16767104) has the molecular formula C7H5N3O2S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| PubChem CID | 16767104 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | NC(=O)c1cnc2sccn2c1=O |
| InChI | InChI=1S/C7H5N3O2S/c8-5(11)4-3-9-7-10(6(4)12)1-2-13-7/h1-3H,(H2,8,11) |
| InChIKey | GBBQGNZTAXSGGH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The IUPAC name of 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (CID 16767104) is 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
What is the SMILES notation for 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The canonical SMILES for 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide is NC(=O)c1cnc2sccn2c1=O.
What is the InChIKey of 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
The InChIKey is GBBQGNZTAXSGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2S/c8-5(11)4-3-9-7-10(6(4)12)1-2-13-7/h1-3H,(H2,8,11).
What are the key properties of 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide?
5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide has a molecular weight of 195.20 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide is sourced from PubChem (CID 16767104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).