C20H27BFN3O3 — CID 167671301
2-(4-fluoro-1-methylpiperidin-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-4-one (PubChem CID 167671301) has the molecular formula C20H27BFN3O3 and a molecular weight of 387.26 g/mol. Its IUPAC name is 2-(4-fluoro-1-methylpiperidin-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(4-fluoro-1-methylpiperidin-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167671301 |
| Molecular Formula | C20H27BFN3O3 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-(4-fluoro-1-methylpiperidin-4-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-4-one |
| SMILES | CN1CCC(F)(c2nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C20H27BFN3O3/c1-18(2)19(3,4)28-21(27-18)13-6-7-15-14(12-13)16(26)24-17(23-15)20(22)8-10-25(5)11-9-20/h6-7,12H,8-11H2,1-5H3,(H,23,24,26) |
| InChIKey | GEGWDKXVTYVDMF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|