C15H17NO5S — CID 16767308
ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate (PubChem CID 16767308) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16767308 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(N2CCOCC2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H17NO5S/c1-2-21-15(17)14-13(16-7-9-20-10-8-16)11-5-3-4-6-12(11)22(14,18)19/h3-6H,2,7-10H2,1H3 |
| InChIKey | UIAZCFRGZNZKRT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |