C14H18BF2NO2 — CID 167674574
N-(4,5-difluoro-1-methyl-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide (PubChem CID 167674574) has the molecular formula C14H18BF2NO2 and a molecular weight of 281.11 g/mol. Its IUPAC name is N-(4,5-difluoro-1-methyl-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide.
| Compound Name | N-(4,5-difluoro-1-methyl-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 167674574 |
| Molecular Formula | C14H18BF2NO2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(4,5-difluoro-1-methyl-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc2c(c(F)c1F)COB2C |
| InChI | InChI=1S/C14H18BF2NO2/c1-5-14(2,3)13(19)18-10-6-9-8(7-20-15(9)4)11(16)12(10)17/h6H,5,7H2,1-4H3,(H,18,19) |
| InChIKey | ISCZBJNCFDTOGZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|