C9H7N5S — CID 16767474
2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 16767474) has the molecular formula C9H7N5S and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline.
| Compound Name | 2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
|---|---|
| PubChem CID | 16767474 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | Nc1ccccc1-c1nn2cnnc2s1 |
| InChI | InChI=1S/C9H7N5S/c10-7-4-2-1-3-6(7)8-13-14-5-11-12-9(14)15-8/h1-5H,10H2 |
| InChIKey | LXBAPDUJKAIRGJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|