C22H24FN3O3S — CID 167674926
N-[2-(5-fluoro-1-methyl-6-phenylbenzimidazol-4-yl)-2-oxoethyl]cyclohexanesulfonamide (PubChem CID 167674926) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-(5-fluoro-1-methyl-6-phenylbenzimidazol-4-yl)-2-oxoethyl]cyclohexanesulfonamide.
| Compound Name | N-[2-(5-fluoro-1-methyl-6-phenylbenzimidazol-4-yl)-2-oxoethyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 167674926 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[2-(5-fluoro-1-methyl-6-phenylbenzimidazol-4-yl)-2-oxoethyl]cyclohexanesulfonamide |
| SMILES | Cn1cnc2c(C(=O)CNS(=O)(=O)C3CCCCC3)c(F)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C22H24FN3O3S/c1-26-14-24-22-18(26)12-17(15-8-4-2-5-9-15)21(23)20(22)19(27)13-25-30(28,29)16-10-6-3-7-11-16/h2,4-5,8-9,12,14,16,25H,3,6-7,10-11,13H2,1H3 |
| InChIKey | HINVQECSQGZDFA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |