About (5-methyl-1,2,4-oxadiazol-3-yl)methanol
(5-methyl-1,2,4-oxadiazol-3-yl)methanol (PubChem CID 16767502) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is (5-methyl-1,2,4-oxadiazol-3-yl)methanol.
Molecular Properties
| Compound Name | (5-methyl-1,2,4-oxadiazol-3-yl)methanol |
| PubChem CID | 16767502 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | (5-methyl-1,2,4-oxadiazol-3-yl)methanol |
| SMILES | Cc1nc(CO)no1 |
| InChI | InChI=1S/C4H6N2O2/c1-3-5-4(2-7)6-8-3/h7H,2H2,1H3 |
| InChIKey | QAMJOTCGJONJDI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,2,4-oxadiazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2,4-oxadiazol-3-yl)methanol?
The IUPAC name of (5-methyl-1,2,4-oxadiazol-3-yl)methanol (CID 16767502) is (5-methyl-1,2,4-oxadiazol-3-yl)methanol.
What is the SMILES notation for (5-methyl-1,2,4-oxadiazol-3-yl)methanol?
The canonical SMILES for (5-methyl-1,2,4-oxadiazol-3-yl)methanol is Cc1nc(CO)no1.
What is the InChIKey of (5-methyl-1,2,4-oxadiazol-3-yl)methanol?
The InChIKey is QAMJOTCGJONJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-3-5-4(2-7)6-8-3/h7H,2H2,1H3.
What are the key properties of (5-methyl-1,2,4-oxadiazol-3-yl)methanol?
(5-methyl-1,2,4-oxadiazol-3-yl)methanol has a molecular weight of 114.10 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2,4-oxadiazol-3-yl)methanol is sourced from PubChem (CID 16767502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).