C20H38O6Si — CID 167676953
[(2R,4S,5S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-methyl-2-pent-4-enoxyoxan-3-yl] acetate (PubChem CID 167676953) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is [(2R,4S,5S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-methyl-2-pent-4-enoxyoxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-methyl-2-pent-4-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 167676953 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(2R,4S,5S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-methyl-2-pent-4-enoxyoxan-3-yl] acetate |
| SMILES | C=CCCCO[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C20H38O6Si/c1-9-10-11-12-23-19-18(25-15(3)21)14(2)17(22)16(26-19)13-24-27(7,8)20(4,5)6/h9,14,16-19,22H,1,10-13H2,2-8H3/t14-,16?,17-,18?,19+/m0/s1 |
| InChIKey | ZWUSGNHVQIUDOI-NFKPGXHRSA-N |
| XLogP | 3.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|