About 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine
7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 16767830) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| PubChem CID | 16767830 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC(C)c1cc(Cl)n2ncnc2n1 |
| InChI | InChI=1S/C8H9ClN4/c1-5(2)6-3-7(9)13-8(12-6)10-4-11-13/h3-5H,1-2H3 |
| InChIKey | ZOHISTHIFGDJGS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine (CID 16767830) is 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine is CC(C)c1cc(Cl)n2ncnc2n1.
What is the InChIKey of 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is ZOHISTHIFGDJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4/c1-5(2)6-3-7(9)13-8(12-6)10-4-11-13/h3-5H,1-2H3.
What are the key properties of 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine?
7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 196.64 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 16767830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).