C29H33BrN4O3 — CID 167678894
methyl 13-bromo-10-methoxy-3,7,7,12,17,17-hexamethyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 167678894) has the molecular formula C29H33BrN4O3 and a molecular weight of 565.51 g/mol. Its IUPAC name is methyl 13-bromo-10-methoxy-3,7,7,12,17,17-hexamethyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl 13-bromo-10-methoxy-3,7,7,12,17,17-hexamethyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 167678894 |
| Molecular Formula | C29H33BrN4O3 |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | methyl 13-bromo-10-methoxy-3,7,7,12,17,17-hexamethyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2cc3nc(c(OC)c4[nH]c(cc5nc(cc1[nH]2)CC5(C)C)c(Br)c4C)CC3(C)C |
| InChI | InChI=1S/C29H33BrN4O3/c1-14-17-10-22-29(5,6)13-20(33-22)26(36-7)25-15(2)24(30)19(34-25)11-21-28(3,4)12-16(31-21)9-18(32-17)23(14)27(35)37-8/h9-11,32,34H,12-13H2,1-8H3/b16-9-,17-10-,18-9-,19-11-,21-11-,22-10-,26-20+,26-25+ |
| InChIKey | XLYTZUOPUXFGLV-FPGUBLMVSA-N |
| XLogP | 6.53 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |