C32H33ClFN5O2 — CID 167680565
4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[(4-oxido-1,2,3,5,6,7-hexahydropyrrolizin-4-ium-8-yl)methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 167680565) has the molecular formula C32H33ClFN5O2 and a molecular weight of 574.10 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[(4-oxido-1,2,3,5,6,7-hexahydropyrrolizin-4-ium-8-yl)methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[(4-oxido-1,2,3,5,6,7-hexahydropyrrolizin-4-ium-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 167680565 |
| Molecular Formula | C32H33ClFN5O2 |
| Molecular Weight | 574.10 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[(4-oxido-1,2,3,5,6,7-hexahydropyrrolizin-4-ium-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | [O-][N+]12CCCC1(COc1nc(N3CC4CCC(C4)C3)c3cnc(-c4cccc5cccc(Cl)c45)c(F)c3n1)CCC2 |
| InChI | InChI=1S/C32H33ClFN5O2/c33-25-8-2-6-22-5-1-7-23(26(22)25)28-27(34)29-24(16-35-28)30(38-17-20-9-10-21(15-20)18-38)37-31(36-29)41-19-32-11-3-13-39(32,40)14-4-12-32/h1-2,5-8,16,20-21H,3-4,9-15,17-19H2 |
| InChIKey | ABDFAZPSJDMIOW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.10 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|