C8H9N3O2 — CID 16768120
5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 16768120) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 16768120 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1cc(-c2nnc(N)o2)c(C)o1 |
| InChI | InChI=1S/C8H9N3O2/c1-4-3-6(5(2)12-4)7-10-11-8(9)13-7/h3H,1-2H3,(H2,9,11) |
| InChIKey | YAKHQTKBLTVDPB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |