C15H10F3N3 — CID 167681435
1-(2-azidoethyl)-3-(trifluoromethyl)benzene;hexa-1,3,5-triyne (PubChem CID 167681435) has the molecular formula C15H10F3N3 and a molecular weight of 289.26 g/mol. Its IUPAC name is 1-(2-azidoethyl)-3-(trifluoromethyl)benzene;hexa-1,3,5-triyne.
| Compound Name | 1-(2-azidoethyl)-3-(trifluoromethyl)benzene;hexa-1,3,5-triyne |
|---|---|
| PubChem CID | 167681435 |
| Molecular Formula | C15H10F3N3 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(2-azidoethyl)-3-(trifluoromethyl)benzene;hexa-1,3,5-triyne |
| SMILES | C#CC#CC#C.[N-]=[N+]=NCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F3N3.C6H2/c10-9(11,12)8-3-1-2-7(6-8)4-5-14-15-13;1-3-5-6-4-2/h1-3,6H,4-5H2;1-2H |
| InChIKey | VPEPFZQDUSMZQM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|