5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid

C9H14N2O3S — CID 16768148

IUPAC5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCOCCCNc1snc(C)c1C(=O)O
InChIInChI=1S/C9H14N2O3S/c1-6-7(9(12)13)8(15-11-6)10-4-3-5-14-2/h10H,3-5H2,1-2H3,(H,12,13)
InChIKeyFBHKKPODXGUYDW-UHFFFAOYSA-N
MW230.29 g/mol
LogP1.60
Rot. Bonds6

About 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid

5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 16768148) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid
PubChem CID16768148
Molecular FormulaC9H14N2O3S
Molecular Weight230.29 g/mol
Exact Mass230.07
IUPAC Name5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCOCCCNc1snc(C)c1C(=O)O
InChIInChI=1S/C9H14N2O3S/c1-6-7(9(12)13)8(15-11-6)10-4-3-5-14-2/h10H,3-5H2,1-2H3,(H,12,13)
InChIKeyFBHKKPODXGUYDW-UHFFFAOYSA-N
XLogP1.60
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.29
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid (CID 16768148) is 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid is COCCCNc1snc(C)c1C(=O)O.
What is the InChIKey of 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is FBHKKPODXGUYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-6-7(9(12)13)8(15-11-6)10-4-3-5-14-2/h10H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid?
5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 230.29 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxypropylamino)-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 16768148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).