C25H33N2O2P — CID 167682088
N-[(1R,2R)-2-(3-diphenylphosphanylpropanoylamino)cyclohexyl]butanamide (PubChem CID 167682088) has the molecular formula C25H33N2O2P and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3-diphenylphosphanylpropanoylamino)cyclohexyl]butanamide.
| Compound Name | N-[(1R,2R)-2-(3-diphenylphosphanylpropanoylamino)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 167682088 |
| Molecular Formula | C25H33N2O2P |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[(1R,2R)-2-(3-diphenylphosphanylpropanoylamino)cyclohexyl]butanamide |
| SMILES | CCCC(=O)N[C@@H]1CCCC[C@H]1NC(=O)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33N2O2P/c1-2-11-24(28)26-22-16-9-10-17-23(22)27-25(29)18-19-30(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,22-23H,2,9-11,16-19H2,1H3,(H,26,28)(H,27,29)/t22-,23-/m1/s1 |
| InChIKey | YYWWTJOMXMJAHL-DHIUTWEWSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|