C22H28FIN2OSi — CID 167682988
2-[[6-(2-ethyl-5-fluoro-4-methylphenyl)-3-iodoindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 167682988) has the molecular formula C22H28FIN2OSi and a molecular weight of 510.47 g/mol. Its IUPAC name is 2-[[6-(2-ethyl-5-fluoro-4-methylphenyl)-3-iodoindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-(2-ethyl-5-fluoro-4-methylphenyl)-3-iodoindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167682988 |
| Molecular Formula | C22H28FIN2OSi |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[[6-(2-ethyl-5-fluoro-4-methylphenyl)-3-iodoindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1cc(C)c(F)cc1-c1ccc2c(I)nn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C22H28FIN2OSi/c1-6-16-11-15(2)20(23)13-19(16)17-7-8-18-21(12-17)26(25-22(18)24)14-27-9-10-28(3,4)5/h7-8,11-13H,6,9-10,14H2,1-5H3 |
| InChIKey | VMIPZOVAYTXEID-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|