About 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one
2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 16768329) has the molecular formula C6H6N4OS2
and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 16768329 |
| Molecular Formula | C6H6N4OS2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CNc1nc2[nH]c(=S)[nH]c(=O)c2s1 |
| InChI | InChI=1S/C6H6N4OS2/c1-7-6-9-3-2(13-6)4(11)10-5(12)8-3/h1H3,(H3,7,8,9,10,11,12) |
| InChIKey | GWBHHYRNIPBOBG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CID 16768329) is 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is CNc1nc2[nH]c(=S)[nH]c(=O)c2s1.
What is the InChIKey of 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The InChIKey is GWBHHYRNIPBOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4OS2/c1-7-6-9-3-2(13-6)4(11)10-5(12)8-3/h1H3,(H3,7,8,9,10,11,12).
What are the key properties of 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one has a molecular weight of 214.27 g/mol, XLogP of 1.08, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-5-sulfanylidene-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 16768329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).