C16H17F4O3S- — CID 167686240
1-[(1R,2S)-2-fluorocyclopropyl]-2-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone;2,2,2-trifluoroacetate (PubChem CID 167686240) has the molecular formula C16H17F4O3S- and a molecular weight of 365.37 g/mol. Its IUPAC name is 1-[(1R,2S)-2-fluorocyclopropyl]-2-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone;2,2,2-trifluoroacetate.
| Compound Name | 1-[(1R,2S)-2-fluorocyclopropyl]-2-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 167686240 |
| Molecular Formula | C16H17F4O3S- |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-[(1R,2S)-2-fluorocyclopropyl]-2-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]ethanone;2,2,2-trifluoroacetate |
| SMILES | C[C@H]1CCc2sc(CC(=O)[C@H]3C[C@@H]3F)cc2C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H17FOS.C2HF3O2/c1-8-2-3-14-9(4-8)5-10(17-14)6-13(16)11-7-12(11)15;3-2(4,5)1(6)7/h5,8,11-12H,2-4,6-7H2,1H3;(H,6,7)/p-1/t8-,11-,12-;/m0./s1 |
| InChIKey | KGWVEILUHPWVBM-SKJXHPPGSA-M |
| XLogP | 2.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |