About N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide
N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide (PubChem CID 167686376) has the molecular formula C17H18N6O
and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide |
| PubChem CID | 167686376 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc2c(cnn2C)cc1Nc1cc(NC(=O)C2CC2)ncn1 |
| InChI | InChI=1S/C17H18N6O/c1-10-5-14-12(8-20-23(14)2)6-13(10)21-15-7-16(19-9-18-15)22-17(24)11-3-4-11/h5-9,11H,3-4H2,1-2H3,(H2,18,19,21,22,24) |
| InChIKey | HFEPSCZMLAODRT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide?
The IUPAC name of N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide (CID 167686376) is N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide?
The canonical SMILES for N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide is Cc1cc2c(cnn2C)cc1Nc1cc(NC(=O)C2CC2)ncn1.
What is the InChIKey of N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide?
The InChIKey is HFEPSCZMLAODRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N6O/c1-10-5-14-12(8-20-23(14)2)6-13(10)21-15-7-16(19-9-18-15)22-17(24)11-3-4-11/h5-9,11H,3-4H2,1-2H3,(H2,18,19,21,22,24).
What are the key properties of N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide?
N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide has a molecular weight of 322.37 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(1,6-dimethylindazol-5-yl)amino]pyrimidin-4-yl]cyclopropanecarboxamide is sourced from PubChem (CID 167686376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).